C26H33ClF3N3O5S — CID 132748643
N-butyl-2-[[2-[4-chloro-N-methylsulfonyl-3-(trifluoromethyl)anilino]acetyl]-[(3-methoxyphenyl)methyl]amino]butanamide (PubChem CID 132748643) has the molecular formula C26H33ClF3N3O5S and a molecular weight of 592.08 g/mol. Its IUPAC name is N-butyl-2-[[2-[4-chloro-N-methylsulfonyl-3-(trifluoromethyl)anilino]acetyl]-[(3-methoxyphenyl)methyl]amino]butanamide.
| Compound Name | N-butyl-2-[[2-[4-chloro-N-methylsulfonyl-3-(trifluoromethyl)anilino]acetyl]-[(3-methoxyphenyl)methyl]amino]butanamide |
|---|---|
| PubChem CID | 132748643 |
| Molecular Formula | C26H33ClF3N3O5S |
| Molecular Weight | 592.08 g/mol |
| Exact Mass | 591.18 |
| IUPAC Name | N-butyl-2-[[2-[4-chloro-N-methylsulfonyl-3-(trifluoromethyl)anilino]acetyl]-[(3-methoxyphenyl)methyl]amino]butanamide |
| SMILES | CCCCNC(=O)C(CC)N(Cc1cccc(OC)c1)C(=O)CN(c1ccc(Cl)c(C(F)(F)F)c1)S(C)(=O)=O |
| InChI | InChI=1S/C26H33ClF3N3O5S/c1-5-7-13-31-25(35)23(6-2)32(16-18-9-8-10-20(14-18)38-3)24(34)17-33(39(4,36)37)19-11-12-22(27)21(15-19)26(28,29)30/h8-12,14-15,23H,5-7,13,16-17H2,1-4H3,(H,31,35) |
| InChIKey | SYMKEDFTTWHKEI-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.08 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|