C25H31ClF3N3O5S — CID 132745144
N-butyl-2-[[2-[4-chloro-N-methylsulfonyl-3-(trifluoromethyl)anilino]acetyl]-[(4-methoxyphenyl)methyl]amino]propanamide (PubChem CID 132745144) has the molecular formula C25H31ClF3N3O5S and a molecular weight of 578.05 g/mol. Its IUPAC name is N-butyl-2-[[2-[4-chloro-N-methylsulfonyl-3-(trifluoromethyl)anilino]acetyl]-[(4-methoxyphenyl)methyl]amino]propanamide.
| Compound Name | N-butyl-2-[[2-[4-chloro-N-methylsulfonyl-3-(trifluoromethyl)anilino]acetyl]-[(4-methoxyphenyl)methyl]amino]propanamide |
|---|---|
| PubChem CID | 132745144 |
| Molecular Formula | C25H31ClF3N3O5S |
| Molecular Weight | 578.05 g/mol |
| Exact Mass | 577.16 |
| IUPAC Name | N-butyl-2-[[2-[4-chloro-N-methylsulfonyl-3-(trifluoromethyl)anilino]acetyl]-[(4-methoxyphenyl)methyl]amino]propanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1ccc(OC)cc1)C(=O)CN(c1ccc(Cl)c(C(F)(F)F)c1)S(C)(=O)=O |
| InChI | InChI=1S/C25H31ClF3N3O5S/c1-5-6-13-30-24(34)17(2)31(15-18-7-10-20(37-3)11-8-18)23(33)16-32(38(4,35)36)19-9-12-22(26)21(14-19)25(27,28)29/h7-12,14,17H,5-6,13,15-16H2,1-4H3,(H,30,34) |
| InChIKey | HHPBKCKWYTYMOQ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.05 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|