C30H36FN3O4S — CID 132739429
2-[[2-[N-(benzenesulfonyl)-3-methylanilino]acetyl]-[(4-fluorophenyl)methyl]amino]-N-butylbutanamide (PubChem CID 132739429) has the molecular formula C30H36FN3O4S and a molecular weight of 553.70 g/mol. Its IUPAC name is 2-[[2-[N-(benzenesulfonyl)-3-methylanilino]acetyl]-[(4-fluorophenyl)methyl]amino]-N-butylbutanamide.
| Compound Name | 2-[[2-[N-(benzenesulfonyl)-3-methylanilino]acetyl]-[(4-fluorophenyl)methyl]amino]-N-butylbutanamide |
|---|---|
| PubChem CID | 132739429 |
| Molecular Formula | C30H36FN3O4S |
| Molecular Weight | 553.70 g/mol |
| Exact Mass | 553.24 |
| IUPAC Name | 2-[[2-[N-(benzenesulfonyl)-3-methylanilino]acetyl]-[(4-fluorophenyl)methyl]amino]-N-butylbutanamide |
| SMILES | CCCCNC(=O)C(CC)N(Cc1ccc(F)cc1)C(=O)CN(c1cccc(C)c1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C30H36FN3O4S/c1-4-6-19-32-30(36)28(5-2)33(21-24-15-17-25(31)18-16-24)29(35)22-34(26-12-10-11-23(3)20-26)39(37,38)27-13-8-7-9-14-27/h7-18,20,28H,4-6,19,21-22H2,1-3H3,(H,32,36) |
| InChIKey | JXQTZZNQCXMKSG-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.70 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|