C26H33Cl2N3O6S — CID 132747576
N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-[2,3-dihydro-1,4-benzodioxin-6-yl(ethylsulfonyl)amino]acetyl]amino]propanamide (PubChem CID 132747576) has the molecular formula C26H33Cl2N3O6S and a molecular weight of 586.54 g/mol. Its IUPAC name is N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-[2,3-dihydro-1,4-benzodioxin-6-yl(ethylsulfonyl)amino]acetyl]amino]propanamide.
| Compound Name | N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-[2,3-dihydro-1,4-benzodioxin-6-yl(ethylsulfonyl)amino]acetyl]amino]propanamide |
|---|---|
| PubChem CID | 132747576 |
| Molecular Formula | C26H33Cl2N3O6S |
| Molecular Weight | 586.54 g/mol |
| Exact Mass | 585.15 |
| IUPAC Name | N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-[2,3-dihydro-1,4-benzodioxin-6-yl(ethylsulfonyl)amino]acetyl]amino]propanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1ccc(Cl)c(Cl)c1)C(=O)CN(c1ccc2c(c1)OCCO2)S(=O)(=O)CC |
| InChI | InChI=1S/C26H33Cl2N3O6S/c1-4-6-11-29-26(33)18(3)30(16-19-7-9-21(27)22(28)14-19)25(32)17-31(38(34,35)5-2)20-8-10-23-24(15-20)37-13-12-36-23/h7-10,14-15,18H,4-6,11-13,16-17H2,1-3H3,(H,29,33) |
| InChIKey | AIYPQNMOICKZMP-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.54 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|