C30H34ClN3O6S — CID 100555297
(2S)-2-[[2-[benzenesulfonyl(2,3-dihydro-1,4-benzodioxin-6-yl)amino]acetyl]-[(3-chlorophenyl)methyl]amino]-N-butylpropanamide (PubChem CID 100555297) has the molecular formula C30H34ClN3O6S and a molecular weight of 600.14 g/mol. Its IUPAC name is (2S)-2-[[2-[benzenesulfonyl(2,3-dihydro-1,4-benzodioxin-6-yl)amino]acetyl]-[(3-chlorophenyl)methyl]amino]-N-butylpropanamide.
| Compound Name | (2S)-2-[[2-[benzenesulfonyl(2,3-dihydro-1,4-benzodioxin-6-yl)amino]acetyl]-[(3-chlorophenyl)methyl]amino]-N-butylpropanamide |
|---|---|
| PubChem CID | 100555297 |
| Molecular Formula | C30H34ClN3O6S |
| Molecular Weight | 600.14 g/mol |
| Exact Mass | 599.19 |
| IUPAC Name | (2S)-2-[[2-[benzenesulfonyl(2,3-dihydro-1,4-benzodioxin-6-yl)amino]acetyl]-[(3-chlorophenyl)methyl]amino]-N-butylpropanamide |
| SMILES | CCCCNC(=O)[C@H](C)N(Cc1cccc(Cl)c1)C(=O)CN(c1ccc2c(c1)OCCO2)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C30H34ClN3O6S/c1-3-4-15-32-30(36)22(2)33(20-23-9-8-10-24(31)18-23)29(35)21-34(41(37,38)26-11-6-5-7-12-26)25-13-14-27-28(19-25)40-17-16-39-27/h5-14,18-19,22H,3-4,15-17,20-21H2,1-2H3,(H,32,36)/t22-/m0/s1 |
| InChIKey | DEFDWFHMFTZSID-QFIPXVFZSA-N |
| XLogP | 4.64 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.14 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|