C28H31BrClN3O4S — CID 100551829
(2R)-2-[[2-[N-(benzenesulfonyl)-3-bromoanilino]acetyl]-[(3-chlorophenyl)methyl]amino]-N-butylpropanamide (PubChem CID 100551829) has the molecular formula C28H31BrClN3O4S and a molecular weight of 621.00 g/mol. Its IUPAC name is (2R)-2-[[2-[N-(benzenesulfonyl)-3-bromoanilino]acetyl]-[(3-chlorophenyl)methyl]amino]-N-butylpropanamide.
| Compound Name | (2R)-2-[[2-[N-(benzenesulfonyl)-3-bromoanilino]acetyl]-[(3-chlorophenyl)methyl]amino]-N-butylpropanamide |
|---|---|
| PubChem CID | 100551829 |
| Molecular Formula | C28H31BrClN3O4S |
| Molecular Weight | 621.00 g/mol |
| Exact Mass | 619.09 |
| IUPAC Name | (2R)-2-[[2-[N-(benzenesulfonyl)-3-bromoanilino]acetyl]-[(3-chlorophenyl)methyl]amino]-N-butylpropanamide |
| SMILES | CCCCNC(=O)[C@@H](C)N(Cc1cccc(Cl)c1)C(=O)CN(c1cccc(Br)c1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C28H31BrClN3O4S/c1-3-4-16-31-28(35)21(2)32(19-22-10-8-12-24(30)17-22)27(34)20-33(25-13-9-11-23(29)18-25)38(36,37)26-14-6-5-7-15-26/h5-15,17-18,21H,3-4,16,19-20H2,1-2H3,(H,31,35)/t21-/m1/s1 |
| InChIKey | JBOBFNLTTUSACR-OAQYLSRUSA-N |
| XLogP | 5.63 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.00 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|