C29H34BrN3O4S — CID 132750557
2-[[2-[N-(benzenesulfonyl)-3-bromoanilino]acetyl]-benzylamino]-N-butylbutanamide (PubChem CID 132750557) has the molecular formula C29H34BrN3O4S and a molecular weight of 600.58 g/mol. Its IUPAC name is 2-[[2-[N-(benzenesulfonyl)-3-bromoanilino]acetyl]-benzylamino]-N-butylbutanamide.
| Compound Name | 2-[[2-[N-(benzenesulfonyl)-3-bromoanilino]acetyl]-benzylamino]-N-butylbutanamide |
|---|---|
| PubChem CID | 132750557 |
| Molecular Formula | C29H34BrN3O4S |
| Molecular Weight | 600.58 g/mol |
| Exact Mass | 599.15 |
| IUPAC Name | 2-[[2-[N-(benzenesulfonyl)-3-bromoanilino]acetyl]-benzylamino]-N-butylbutanamide |
| SMILES | CCCCNC(=O)C(CC)N(Cc1ccccc1)C(=O)CN(c1cccc(Br)c1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C29H34BrN3O4S/c1-3-5-19-31-29(35)27(4-2)32(21-23-13-8-6-9-14-23)28(34)22-33(25-16-12-15-24(30)20-25)38(36,37)26-17-10-7-11-18-26/h6-18,20,27H,3-5,19,21-22H2,1-2H3,(H,31,35) |
| InChIKey | XHVWCDLHDKOCJM-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.58 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|