C28H30BrCl2N3O4S — CID 133152238
2-[(4-bromophenyl)methyl-[2-(3-chloro-N-(4-chlorophenyl)sulfonylanilino)acetyl]amino]-N-butylpropanamide (PubChem CID 133152238) has the molecular formula C28H30BrCl2N3O4S and a molecular weight of 655.44 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methyl-[2-(3-chloro-N-(4-chlorophenyl)sulfonylanilino)acetyl]amino]-N-butylpropanamide.
| Compound Name | 2-[(4-bromophenyl)methyl-[2-(3-chloro-N-(4-chlorophenyl)sulfonylanilino)acetyl]amino]-N-butylpropanamide |
|---|---|
| PubChem CID | 133152238 |
| Molecular Formula | C28H30BrCl2N3O4S |
| Molecular Weight | 655.44 g/mol |
| Exact Mass | 653.05 |
| IUPAC Name | 2-[(4-bromophenyl)methyl-[2-(3-chloro-N-(4-chlorophenyl)sulfonylanilino)acetyl]amino]-N-butylpropanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1ccc(Br)cc1)C(=O)CN(c1cccc(Cl)c1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H30BrCl2N3O4S/c1-3-4-16-32-28(36)20(2)33(18-21-8-10-22(29)11-9-21)27(35)19-34(25-7-5-6-24(31)17-25)39(37,38)26-14-12-23(30)13-15-26/h5-15,17,20H,3-4,16,18-19H2,1-2H3,(H,32,36) |
| InChIKey | ATEIYPNBNRIJQD-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.44 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|