C29H31ClF3N3O4S — CID 100551967
(2R)-2-[[2-[N-(benzenesulfonyl)-3-(trifluoromethyl)anilino]acetyl]-[(3-chlorophenyl)methyl]amino]-N-butylpropanamide (PubChem CID 100551967) has the molecular formula C29H31ClF3N3O4S and a molecular weight of 610.10 g/mol. Its IUPAC name is (2R)-2-[[2-[N-(benzenesulfonyl)-3-(trifluoromethyl)anilino]acetyl]-[(3-chlorophenyl)methyl]amino]-N-butylpropanamide.
| Compound Name | (2R)-2-[[2-[N-(benzenesulfonyl)-3-(trifluoromethyl)anilino]acetyl]-[(3-chlorophenyl)methyl]amino]-N-butylpropanamide |
|---|---|
| PubChem CID | 100551967 |
| Molecular Formula | C29H31ClF3N3O4S |
| Molecular Weight | 610.10 g/mol |
| Exact Mass | 609.17 |
| IUPAC Name | (2R)-2-[[2-[N-(benzenesulfonyl)-3-(trifluoromethyl)anilino]acetyl]-[(3-chlorophenyl)methyl]amino]-N-butylpropanamide |
| SMILES | CCCCNC(=O)[C@@H](C)N(Cc1cccc(Cl)c1)C(=O)CN(c1cccc(C(F)(F)F)c1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C29H31ClF3N3O4S/c1-3-4-16-34-28(38)21(2)35(19-22-10-8-12-24(30)17-22)27(37)20-36(41(39,40)26-14-6-5-7-15-26)25-13-9-11-23(18-25)29(31,32)33/h5-15,17-18,21H,3-4,16,19-20H2,1-2H3,(H,34,38)/t21-/m1/s1 |
| InChIKey | RLKXCUWZVYHERG-OAQYLSRUSA-N |
| XLogP | 5.89 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.10 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|