C26H34Cl3N3O4S — CID 132748556
N-butyl-2-[(2-chlorophenyl)methyl-[4-(2,5-dichloro-N-methylsulfonylanilino)butanoyl]amino]butanamide (PubChem CID 132748556) has the molecular formula C26H34Cl3N3O4S and a molecular weight of 591.00 g/mol. Its IUPAC name is N-butyl-2-[(2-chlorophenyl)methyl-[4-(2,5-dichloro-N-methylsulfonylanilino)butanoyl]amino]butanamide.
| Compound Name | N-butyl-2-[(2-chlorophenyl)methyl-[4-(2,5-dichloro-N-methylsulfonylanilino)butanoyl]amino]butanamide |
|---|---|
| PubChem CID | 132748556 |
| Molecular Formula | C26H34Cl3N3O4S |
| Molecular Weight | 591.00 g/mol |
| Exact Mass | 589.13 |
| IUPAC Name | N-butyl-2-[(2-chlorophenyl)methyl-[4-(2,5-dichloro-N-methylsulfonylanilino)butanoyl]amino]butanamide |
| SMILES | CCCCNC(=O)C(CC)N(Cc1ccccc1Cl)C(=O)CCCN(c1cc(Cl)ccc1Cl)S(C)(=O)=O |
| InChI | InChI=1S/C26H34Cl3N3O4S/c1-4-6-15-30-26(34)23(5-2)31(18-19-10-7-8-11-21(19)28)25(33)12-9-16-32(37(3,35)36)24-17-20(27)13-14-22(24)29/h7-8,10-11,13-14,17,23H,4-6,9,12,15-16,18H2,1-3H3,(H,30,34) |
| InChIKey | NRDIFHPPFYYOOV-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.00 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|