C27H37Cl2N3O4S — CID 132743724
N-butyl-2-[4-(2,5-dichloro-N-methylsulfonylanilino)butanoyl-(2-phenylethyl)amino]butanamide (PubChem CID 132743724) has the molecular formula C27H37Cl2N3O4S and a molecular weight of 570.58 g/mol. Its IUPAC name is N-butyl-2-[4-(2,5-dichloro-N-methylsulfonylanilino)butanoyl-(2-phenylethyl)amino]butanamide.
| Compound Name | N-butyl-2-[4-(2,5-dichloro-N-methylsulfonylanilino)butanoyl-(2-phenylethyl)amino]butanamide |
|---|---|
| PubChem CID | 132743724 |
| Molecular Formula | C27H37Cl2N3O4S |
| Molecular Weight | 570.58 g/mol |
| Exact Mass | 569.19 |
| IUPAC Name | N-butyl-2-[4-(2,5-dichloro-N-methylsulfonylanilino)butanoyl-(2-phenylethyl)amino]butanamide |
| SMILES | CCCCNC(=O)C(CC)N(CCc1ccccc1)C(=O)CCCN(c1cc(Cl)ccc1Cl)S(C)(=O)=O |
| InChI | InChI=1S/C27H37Cl2N3O4S/c1-4-6-17-30-27(34)24(5-2)31(19-16-21-11-8-7-9-12-21)26(33)13-10-18-32(37(3,35)36)25-20-22(28)14-15-23(25)29/h7-9,11-12,14-15,20,24H,4-6,10,13,16-19H2,1-3H3,(H,30,34) |
| InChIKey | BHUOVYDHHXJDJS-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.58 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|