C31H38ClN3O5S — CID 132750316
N-butyl-2-[[2-(N-(4-chlorophenyl)sulfonyl-2-ethoxyanilino)acetyl]-[(4-methylphenyl)methyl]amino]propanamide (PubChem CID 132750316) has the molecular formula C31H38ClN3O5S and a molecular weight of 600.18 g/mol. Its IUPAC name is N-butyl-2-[[2-(N-(4-chlorophenyl)sulfonyl-2-ethoxyanilino)acetyl]-[(4-methylphenyl)methyl]amino]propanamide.
| Compound Name | N-butyl-2-[[2-(N-(4-chlorophenyl)sulfonyl-2-ethoxyanilino)acetyl]-[(4-methylphenyl)methyl]amino]propanamide |
|---|---|
| PubChem CID | 132750316 |
| Molecular Formula | C31H38ClN3O5S |
| Molecular Weight | 600.18 g/mol |
| Exact Mass | 599.22 |
| IUPAC Name | N-butyl-2-[[2-(N-(4-chlorophenyl)sulfonyl-2-ethoxyanilino)acetyl]-[(4-methylphenyl)methyl]amino]propanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1ccc(C)cc1)C(=O)CN(c1ccccc1OCC)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C31H38ClN3O5S/c1-5-7-20-33-31(37)24(4)34(21-25-14-12-23(3)13-15-25)30(36)22-35(28-10-8-9-11-29(28)40-6-2)41(38,39)27-18-16-26(32)17-19-27/h8-19,24H,5-7,20-22H2,1-4H3,(H,33,37) |
| InChIKey | PYXKJCGIBPKVOM-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.18 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|