C31H36ClN3O6S — CID 132752777
2-[[2-[benzenesulfonyl(2,3-dihydro-1,4-benzodioxin-6-yl)amino]acetyl]-[(2-chlorophenyl)methyl]amino]-N-butylbutanamide (PubChem CID 132752777) has the molecular formula C31H36ClN3O6S and a molecular weight of 614.16 g/mol. Its IUPAC name is 2-[[2-[benzenesulfonyl(2,3-dihydro-1,4-benzodioxin-6-yl)amino]acetyl]-[(2-chlorophenyl)methyl]amino]-N-butylbutanamide.
| Compound Name | 2-[[2-[benzenesulfonyl(2,3-dihydro-1,4-benzodioxin-6-yl)amino]acetyl]-[(2-chlorophenyl)methyl]amino]-N-butylbutanamide |
|---|---|
| PubChem CID | 132752777 |
| Molecular Formula | C31H36ClN3O6S |
| Molecular Weight | 614.16 g/mol |
| Exact Mass | 613.20 |
| IUPAC Name | 2-[[2-[benzenesulfonyl(2,3-dihydro-1,4-benzodioxin-6-yl)amino]acetyl]-[(2-chlorophenyl)methyl]amino]-N-butylbutanamide |
| SMILES | CCCCNC(=O)C(CC)N(Cc1ccccc1Cl)C(=O)CN(c1ccc2c(c1)OCCO2)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C31H36ClN3O6S/c1-3-5-17-33-31(37)27(4-2)34(21-23-11-9-10-14-26(23)32)30(36)22-35(42(38,39)25-12-7-6-8-13-25)24-15-16-28-29(20-24)41-19-18-40-28/h6-16,20,27H,3-5,17-19,21-22H2,1-2H3,(H,33,37) |
| InChIKey | QFKSSLZMAOFZIE-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.16 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|