C31H37Cl2N3O4S — CID 132753645
2-[[2-[N-(benzenesulfonyl)-2,3-dimethylanilino]acetyl]-[(2,4-dichlorophenyl)methyl]amino]-N-butylbutanamide (PubChem CID 132753645) has the molecular formula C31H37Cl2N3O4S and a molecular weight of 618.63 g/mol. Its IUPAC name is 2-[[2-[N-(benzenesulfonyl)-2,3-dimethylanilino]acetyl]-[(2,4-dichlorophenyl)methyl]amino]-N-butylbutanamide.
| Compound Name | 2-[[2-[N-(benzenesulfonyl)-2,3-dimethylanilino]acetyl]-[(2,4-dichlorophenyl)methyl]amino]-N-butylbutanamide |
|---|---|
| PubChem CID | 132753645 |
| Molecular Formula | C31H37Cl2N3O4S |
| Molecular Weight | 618.63 g/mol |
| Exact Mass | 617.19 |
| IUPAC Name | 2-[[2-[N-(benzenesulfonyl)-2,3-dimethylanilino]acetyl]-[(2,4-dichlorophenyl)methyl]amino]-N-butylbutanamide |
| SMILES | CCCCNC(=O)C(CC)N(Cc1ccc(Cl)cc1Cl)C(=O)CN(c1cccc(C)c1C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C31H37Cl2N3O4S/c1-5-7-18-34-31(38)28(6-2)35(20-24-16-17-25(32)19-27(24)33)30(37)21-36(29-15-11-12-22(3)23(29)4)41(39,40)26-13-9-8-10-14-26/h8-17,19,28H,5-7,18,20-21H2,1-4H3,(H,34,38) |
| InChIKey | UBIWKNPDUQBBJV-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.63 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|