C28H29Cl4N3O4S — CID 132757076
2-[[2-[N-(benzenesulfonyl)-2,5-dichloroanilino]acetyl]-[(3,4-dichlorophenyl)methyl]amino]-N-butylpropanamide (PubChem CID 132757076) has the molecular formula C28H29Cl4N3O4S and a molecular weight of 645.44 g/mol. Its IUPAC name is 2-[[2-[N-(benzenesulfonyl)-2,5-dichloroanilino]acetyl]-[(3,4-dichlorophenyl)methyl]amino]-N-butylpropanamide.
| Compound Name | 2-[[2-[N-(benzenesulfonyl)-2,5-dichloroanilino]acetyl]-[(3,4-dichlorophenyl)methyl]amino]-N-butylpropanamide |
|---|---|
| PubChem CID | 132757076 |
| Molecular Formula | C28H29Cl4N3O4S |
| Molecular Weight | 645.44 g/mol |
| Exact Mass | 643.06 |
| IUPAC Name | 2-[[2-[N-(benzenesulfonyl)-2,5-dichloroanilino]acetyl]-[(3,4-dichlorophenyl)methyl]amino]-N-butylpropanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1ccc(Cl)c(Cl)c1)C(=O)CN(c1cc(Cl)ccc1Cl)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C28H29Cl4N3O4S/c1-3-4-14-33-28(37)19(2)34(17-20-10-12-23(30)25(32)15-20)27(36)18-35(26-16-21(29)11-13-24(26)31)40(38,39)22-8-6-5-7-9-22/h5-13,15-16,19H,3-4,14,17-18H2,1-2H3,(H,33,37) |
| InChIKey | QYYTWPITKGLPMQ-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.44 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|