C32H39Cl2N3O5S — CID 132757330
N-butyl-2-[(2,4-dichlorophenyl)methyl-[2-(4-ethoxy-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]butanamide (PubChem CID 132757330) has the molecular formula C32H39Cl2N3O5S and a molecular weight of 648.65 g/mol. Its IUPAC name is N-butyl-2-[(2,4-dichlorophenyl)methyl-[2-(4-ethoxy-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]butanamide.
| Compound Name | N-butyl-2-[(2,4-dichlorophenyl)methyl-[2-(4-ethoxy-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]butanamide |
|---|---|
| PubChem CID | 132757330 |
| Molecular Formula | C32H39Cl2N3O5S |
| Molecular Weight | 648.65 g/mol |
| Exact Mass | 647.20 |
| IUPAC Name | N-butyl-2-[(2,4-dichlorophenyl)methyl-[2-(4-ethoxy-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]butanamide |
| SMILES | CCCCNC(=O)C(CC)N(Cc1ccc(Cl)cc1Cl)C(=O)CN(c1ccc(OCC)cc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C32H39Cl2N3O5S/c1-5-8-19-35-32(39)30(6-2)36(21-24-11-12-25(33)20-29(24)34)31(38)22-37(26-13-15-27(16-14-26)42-7-3)43(40,41)28-17-9-23(4)10-18-28/h9-18,20,30H,5-8,19,21-22H2,1-4H3,(H,35,39) |
| InChIKey | NFMXAZJRYPJJPX-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.65 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|