C30H34BrCl2N3O5S — CID 132759407
2-[[2-(N-(4-bromophenyl)sulfonyl-4-ethoxyanilino)acetyl]-[(2,4-dichlorophenyl)methyl]amino]-N-butylpropanamide (PubChem CID 132759407) has the molecular formula C30H34BrCl2N3O5S and a molecular weight of 699.50 g/mol. Its IUPAC name is 2-[[2-(N-(4-bromophenyl)sulfonyl-4-ethoxyanilino)acetyl]-[(2,4-dichlorophenyl)methyl]amino]-N-butylpropanamide.
| Compound Name | 2-[[2-(N-(4-bromophenyl)sulfonyl-4-ethoxyanilino)acetyl]-[(2,4-dichlorophenyl)methyl]amino]-N-butylpropanamide |
|---|---|
| PubChem CID | 132759407 |
| Molecular Formula | C30H34BrCl2N3O5S |
| Molecular Weight | 699.50 g/mol |
| Exact Mass | 697.08 |
| IUPAC Name | 2-[[2-(N-(4-bromophenyl)sulfonyl-4-ethoxyanilino)acetyl]-[(2,4-dichlorophenyl)methyl]amino]-N-butylpropanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1ccc(Cl)cc1Cl)C(=O)CN(c1ccc(OCC)cc1)S(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C30H34BrCl2N3O5S/c1-4-6-17-34-30(38)21(3)35(19-22-7-10-24(32)18-28(22)33)29(37)20-36(25-11-13-26(14-12-25)41-5-2)42(39,40)27-15-8-23(31)9-16-27/h7-16,18,21H,4-6,17,19-20H2,1-3H3,(H,34,38) |
| InChIKey | OETXKFHMUSGKQZ-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.50 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|