C24H23N3O3 — CID 132763638
[1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] (Z)-2-cyano-3-[4-(dimethylamino)phenyl]prop-2-enoate (PubChem CID 132763638) has the molecular formula C24H23N3O3 and a molecular weight of 401.47 g/mol. Its IUPAC name is [1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] (Z)-2-cyano-3-[4-(dimethylamino)phenyl]prop-2-enoate.
| Compound Name | [1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] (Z)-2-cyano-3-[4-(dimethylamino)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 132763638 |
| Molecular Formula | C24H23N3O3 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | [1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl] (Z)-2-cyano-3-[4-(dimethylamino)phenyl]prop-2-enoate |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)C(C)OC(=O)/C(C#N)=C\c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C24H23N3O3/c1-15-22(20-7-5-6-8-21(20)26-15)23(28)16(2)30-24(29)18(14-25)13-17-9-11-19(12-10-17)27(3)4/h5-13,16,26H,1-4H3/b18-13- |
| InChIKey | XKXLNVDGKGQCOZ-AQTBWJFISA-N |
| XLogP | 4.26 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|