C18H23N7O2S — CID 132771700
2-[[4-[1-(cyanomethyl)piperidin-3-yl]pyrimidin-2-yl]amino]-N-(3-hydroxypropyl)-1,3-thiazole-4-carboxamide (PubChem CID 132771700) has the molecular formula C18H23N7O2S and a molecular weight of 401.50 g/mol. Its IUPAC name is 2-[[4-[1-(cyanomethyl)piperidin-3-yl]pyrimidin-2-yl]amino]-N-(3-hydroxypropyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[[4-[1-(cyanomethyl)piperidin-3-yl]pyrimidin-2-yl]amino]-N-(3-hydroxypropyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 132771700 |
| Molecular Formula | C18H23N7O2S |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 2-[[4-[1-(cyanomethyl)piperidin-3-yl]pyrimidin-2-yl]amino]-N-(3-hydroxypropyl)-1,3-thiazole-4-carboxamide |
| SMILES | N#CCN1CCCC(c2ccnc(Nc3nc(C(=O)NCCCO)cs3)n2)C1 |
| InChI | InChI=1S/C18H23N7O2S/c19-5-9-25-8-1-3-13(11-25)14-4-7-21-17(22-14)24-18-23-15(12-28-18)16(27)20-6-2-10-26/h4,7,12-13,26H,1-3,6,8-11H2,(H,20,27)(H,21,22,23,24) |
| InChIKey | LUFAMOQSVZEJRN-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 127.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|