C24H23N7 — CID 132771847
5-[[5-[1-(1H-indol-5-ylmethyl)piperidin-2-yl]pyrazin-2-yl]amino]pyridine-2-carbonitrile (PubChem CID 132771847) has the molecular formula C24H23N7 and a molecular weight of 409.50 g/mol. Its IUPAC name is 5-[[5-[1-(1H-indol-5-ylmethyl)piperidin-2-yl]pyrazin-2-yl]amino]pyridine-2-carbonitrile.
| Compound Name | 5-[[5-[1-(1H-indol-5-ylmethyl)piperidin-2-yl]pyrazin-2-yl]amino]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 132771847 |
| Molecular Formula | C24H23N7 |
| Molecular Weight | 409.50 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | 5-[[5-[1-(1H-indol-5-ylmethyl)piperidin-2-yl]pyrazin-2-yl]amino]pyridine-2-carbonitrile |
| SMILES | N#Cc1ccc(Nc2cnc(C3CCCCN3Cc3ccc4[nH]ccc4c3)cn2)cn1 |
| InChI | InChI=1S/C24H23N7/c25-12-19-5-6-20(13-27-19)30-24-15-28-22(14-29-24)23-3-1-2-10-31(23)16-17-4-7-21-18(11-17)8-9-26-21/h4-9,11,13-15,23,26H,1-3,10,16H2,(H,29,30) |
| InChIKey | AWFIVJJHWJCIAM-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 93.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.50 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |