C24H26N6 — CID 132778232
5-[[6-[1-[[4-(dimethylamino)phenyl]methyl]pyrrolidin-2-yl]-2-pyridinyl]amino]pyridine-2-carbonitrile (PubChem CID 132778232) has the molecular formula C24H26N6 and a molecular weight of 398.51 g/mol. Its IUPAC name is 5-[[6-[1-[[4-(dimethylamino)phenyl]methyl]pyrrolidin-2-yl]-2-pyridinyl]amino]pyridine-2-carbonitrile.
| Compound Name | 5-[[6-[1-[[4-(dimethylamino)phenyl]methyl]pyrrolidin-2-yl]-2-pyridinyl]amino]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 132778232 |
| Molecular Formula | C24H26N6 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | 5-[[6-[1-[[4-(dimethylamino)phenyl]methyl]pyrrolidin-2-yl]-2-pyridinyl]amino]pyridine-2-carbonitrile |
| SMILES | CN(C)c1ccc(CN2CCCC2c2cccc(Nc3ccc(C#N)nc3)n2)cc1 |
| InChI | InChI=1S/C24H26N6/c1-29(2)21-12-8-18(9-13-21)17-30-14-4-6-23(30)22-5-3-7-24(28-22)27-20-11-10-19(15-25)26-16-20/h3,5,7-13,16,23H,4,6,14,17H2,1-2H3,(H,27,28) |
| InChIKey | YYZYACGSCLFBDW-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 68.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|