C27H32F2N2O6 — CID 132774097
4-(2-fluorophenoxy)-1-[2-[(4-fluorophenoxy)methyl]-2-(2-morpholin-4-yl-2-oxoethyl)morpholin-4-yl]butan-1-one (PubChem CID 132774097) has the molecular formula C27H32F2N2O6 and a molecular weight of 518.56 g/mol. Its IUPAC name is 4-(2-fluorophenoxy)-1-[2-[(4-fluorophenoxy)methyl]-2-(2-morpholin-4-yl-2-oxoethyl)morpholin-4-yl]butan-1-one.
| Compound Name | 4-(2-fluorophenoxy)-1-[2-[(4-fluorophenoxy)methyl]-2-(2-morpholin-4-yl-2-oxoethyl)morpholin-4-yl]butan-1-one |
|---|---|
| PubChem CID | 132774097 |
| Molecular Formula | C27H32F2N2O6 |
| Molecular Weight | 518.56 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | 4-(2-fluorophenoxy)-1-[2-[(4-fluorophenoxy)methyl]-2-(2-morpholin-4-yl-2-oxoethyl)morpholin-4-yl]butan-1-one |
| SMILES | O=C(CC1(COc2ccc(F)cc2)CN(C(=O)CCCOc2ccccc2F)CCO1)N1CCOCC1 |
| InChI | InChI=1S/C27H32F2N2O6/c28-21-7-9-22(10-8-21)36-20-27(18-26(33)30-11-15-34-16-12-30)19-31(13-17-37-27)25(32)6-3-14-35-24-5-2-1-4-23(24)29/h1-2,4-5,7-10H,3,6,11-20H2 |
| InChIKey | GOHDXZLZPWCYFI-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.56 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|