C26H37BrClN3O9 — CID 132774703
(2S,3S,4R,5R)-5-acetamido-2-[(5-bromo-4-chloro-1H-indol-3-yl)oxy]-4-hydroxy-3-methyl-6-(1,2,3-trihydroxypropyl)oxane-2-carboxylate;cyclohexylazanium (PubChem CID 132774703) has the molecular formula C26H37BrClN3O9 and a molecular weight of 650.95 g/mol. Its IUPAC name is (2S,3S,4R,5R)-5-acetamido-2-[(5-bromo-4-chloro-1H-indol-3-yl)oxy]-4-hydroxy-3-methyl-6-(1,2,3-trihydroxypropyl)oxane-2-carboxylate;cyclohexylazanium.
| Compound Name | (2S,3S,4R,5R)-5-acetamido-2-[(5-bromo-4-chloro-1H-indol-3-yl)oxy]-4-hydroxy-3-methyl-6-(1,2,3-trihydroxypropyl)oxane-2-carboxylate;cyclohexylazanium |
|---|---|
| PubChem CID | 132774703 |
| Molecular Formula | C26H37BrClN3O9 |
| Molecular Weight | 650.95 g/mol |
| Exact Mass | 649.14 |
| IUPAC Name | (2S,3S,4R,5R)-5-acetamido-2-[(5-bromo-4-chloro-1H-indol-3-yl)oxy]-4-hydroxy-3-methyl-6-(1,2,3-trihydroxypropyl)oxane-2-carboxylate;cyclohexylazanium |
| SMILES | CC(=O)N[C@H]1C(C(O)C(O)CO)O[C@@](Oc2c[nH]c3ccc(Br)c(Cl)c23)(C(=O)[O-])[C@@H](C)[C@H]1O.[NH3+]C1CCCCC1 |
| InChI | InChI=1S/C20H24BrClN2O9.C6H13N/c1-7-16(28)15(24-8(2)26)18(17(29)11(27)6-25)33-20(7,19(30)31)32-12-5-23-10-4-3-9(21)14(22)13(10)12;7-6-4-2-1-3-5-6/h3-5,7,11,15-18,23,25,27-29H,6H2,1-2H3,(H,24,26)(H,30,31);6H,1-5,7H2/t7-,11?,15+,16+,17?,18?,20+;/m0./s1 |
| InChIKey | MEWYHLRJNKVZFV-ZDNIAUTJSA-N |
| XLogP | -0.42 |
| TPSA | 212.04 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.95 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |