C14H17N3O3S2 — CID 132777127
3-(1-methylsulfonylpiperidin-3-yl)thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 132777127) has the molecular formula C14H17N3O3S2 and a molecular weight of 339.44 g/mol. Its IUPAC name is 3-(1-methylsulfonylpiperidin-3-yl)thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-(1-methylsulfonylpiperidin-3-yl)thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 132777127 |
| Molecular Formula | C14H17N3O3S2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | 3-(1-methylsulfonylpiperidin-3-yl)thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | CS(=O)(=O)N1CCCC(c2c(C(N)=O)sc3ncccc23)C1 |
| InChI | InChI=1S/C14H17N3O3S2/c1-22(19,20)17-7-3-4-9(8-17)11-10-5-2-6-16-14(10)21-12(11)13(15)18/h2,5-6,9H,3-4,7-8H2,1H3,(H2,15,18) |
| InChIKey | KGXZCVOSMMLJIM-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |