C25H31N3O4 — CID 132779090
1-[2-[2-[3-(2-methoxyphenyl)-4-methylpiperazine-1-carbonyl]phenoxy]ethyl]pyrrolidin-2-one (PubChem CID 132779090) has the molecular formula C25H31N3O4 and a molecular weight of 437.54 g/mol. Its IUPAC name is 1-[2-[2-[3-(2-methoxyphenyl)-4-methylpiperazine-1-carbonyl]phenoxy]ethyl]pyrrolidin-2-one.
| Compound Name | 1-[2-[2-[3-(2-methoxyphenyl)-4-methylpiperazine-1-carbonyl]phenoxy]ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 132779090 |
| Molecular Formula | C25H31N3O4 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | 1-[2-[2-[3-(2-methoxyphenyl)-4-methylpiperazine-1-carbonyl]phenoxy]ethyl]pyrrolidin-2-one |
| SMILES | COc1ccccc1C1CN(C(=O)c2ccccc2OCCN2CCCC2=O)CCN1C |
| InChI | InChI=1S/C25H31N3O4/c1-26-14-15-28(18-21(26)19-8-3-5-10-22(19)31-2)25(30)20-9-4-6-11-23(20)32-17-16-27-13-7-12-24(27)29/h3-6,8-11,21H,7,12-18H2,1-2H3 |
| InChIKey | DQFZHUDMNJWXGA-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |