C26H28N4O3 — CID 132779301
2-[1-(2-ethoxybenzoyl)piperidin-2-yl]-4-methyl-N-phenylpyrimidine-5-carboxamide (PubChem CID 132779301) has the molecular formula C26H28N4O3 and a molecular weight of 444.54 g/mol. Its IUPAC name is 2-[1-(2-ethoxybenzoyl)piperidin-2-yl]-4-methyl-N-phenylpyrimidine-5-carboxamide.
| Compound Name | 2-[1-(2-ethoxybenzoyl)piperidin-2-yl]-4-methyl-N-phenylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 132779301 |
| Molecular Formula | C26H28N4O3 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | 2-[1-(2-ethoxybenzoyl)piperidin-2-yl]-4-methyl-N-phenylpyrimidine-5-carboxamide |
| SMILES | CCOc1ccccc1C(=O)N1CCCCC1c1ncc(C(=O)Nc2ccccc2)c(C)n1 |
| InChI | InChI=1S/C26H28N4O3/c1-3-33-23-15-8-7-13-20(23)26(32)30-16-10-9-14-22(30)24-27-17-21(18(2)28-24)25(31)29-19-11-5-4-6-12-19/h4-8,11-13,15,17,22H,3,9-10,14,16H2,1-2H3,(H,29,31) |
| InChIKey | AQFVJZGZTNQWBM-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |