C13H9F7O2 — CID 132821338
2-(2,2,3,3,4,4,4-heptafluorobutyl)-2,3-dihydro-1-benzofuran-4-carbaldehyde (PubChem CID 132821338) has the molecular formula C13H9F7O2 and a molecular weight of 330.20 g/mol. Its IUPAC name is 2-(2,2,3,3,4,4,4-heptafluorobutyl)-2,3-dihydro-1-benzofuran-4-carbaldehyde.
| Compound Name | 2-(2,2,3,3,4,4,4-heptafluorobutyl)-2,3-dihydro-1-benzofuran-4-carbaldehyde |
|---|---|
| PubChem CID | 132821338 |
| Molecular Formula | C13H9F7O2 |
| Molecular Weight | 330.20 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 2-(2,2,3,3,4,4,4-heptafluorobutyl)-2,3-dihydro-1-benzofuran-4-carbaldehyde |
| SMILES | O=Cc1cccc2c1CC(CC(F)(F)C(F)(F)C(F)(F)F)O2 |
| InChI | InChI=1S/C13H9F7O2/c14-11(15,12(16,17)13(18,19)20)5-8-4-9-7(6-21)2-1-3-10(9)22-8/h1-3,6,8H,4-5H2 |
| InChIKey | FCOZALKUIMEBSL-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.20 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|