C15H13BrF2O5S — CID 132821473
methyl 6-bromo-2-(2-ethoxy-1,1-difluoro-2-oxoethyl)sulfanyl-3-oxo-1H-indene-2-carboxylate (PubChem CID 132821473) has the molecular formula C15H13BrF2O5S and a molecular weight of 423.23 g/mol. Its IUPAC name is methyl 6-bromo-2-(2-ethoxy-1,1-difluoro-2-oxoethyl)sulfanyl-3-oxo-1H-indene-2-carboxylate.
| Compound Name | methyl 6-bromo-2-(2-ethoxy-1,1-difluoro-2-oxoethyl)sulfanyl-3-oxo-1H-indene-2-carboxylate |
|---|---|
| PubChem CID | 132821473 |
| Molecular Formula | C15H13BrF2O5S |
| Molecular Weight | 423.23 g/mol |
| Exact Mass | 421.96 |
| IUPAC Name | methyl 6-bromo-2-(2-ethoxy-1,1-difluoro-2-oxoethyl)sulfanyl-3-oxo-1H-indene-2-carboxylate |
| SMILES | CCOC(=O)C(F)(F)SC1(C(=O)OC)Cc2cc(Br)ccc2C1=O |
| InChI | InChI=1S/C15H13BrF2O5S/c1-3-23-13(21)15(17,18)24-14(12(20)22-2)7-8-6-9(16)4-5-10(8)11(14)19/h4-6H,3,7H2,1-2H3 |
| InChIKey | IDEYWXYRFMRRDX-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.23 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|