C15H16O3S — CID 13283216
(6-formyl-3-phenylsulfanylcyclohex-2-en-1-yl) acetate (PubChem CID 13283216) has the molecular formula C15H16O3S and a molecular weight of 276.36 g/mol. Its IUPAC name is (6-formyl-3-phenylsulfanylcyclohex-2-en-1-yl) acetate.
| Compound Name | (6-formyl-3-phenylsulfanylcyclohex-2-en-1-yl) acetate |
|---|---|
| PubChem CID | 13283216 |
| Molecular Formula | C15H16O3S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | (6-formyl-3-phenylsulfanylcyclohex-2-en-1-yl) acetate |
| SMILES | CC(=O)OC1C=C(Sc2ccccc2)CCC1C=O |
| InChI | InChI=1S/C15H16O3S/c1-11(17)18-15-9-14(8-7-12(15)10-16)19-13-5-3-2-4-6-13/h2-6,9-10,12,15H,7-8H2,1H3 |
| InChIKey | ISDWSGFYBCKYNE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|