C16H18O3S — CID 134865423
(5-formyl-5-methyl-4-phenylsulfanylcyclohex-2-en-1-yl) acetate (PubChem CID 134865423) has the molecular formula C16H18O3S and a molecular weight of 290.38 g/mol. Its IUPAC name is (5-formyl-5-methyl-4-phenylsulfanylcyclohex-2-en-1-yl) acetate.
| Compound Name | (5-formyl-5-methyl-4-phenylsulfanylcyclohex-2-en-1-yl) acetate |
|---|---|
| PubChem CID | 134865423 |
| Molecular Formula | C16H18O3S |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | (5-formyl-5-methyl-4-phenylsulfanylcyclohex-2-en-1-yl) acetate |
| SMILES | CC(=O)OC1C=CC(Sc2ccccc2)C(C)(C=O)C1 |
| InChI | InChI=1S/C16H18O3S/c1-12(18)19-13-8-9-15(16(2,10-13)11-17)20-14-6-4-3-5-7-14/h3-9,11,13,15H,10H2,1-2H3 |
| InChIKey | ONXZETURSPJNOT-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|