C22H26O3S — CID 5384914
[(1R)-3-formyl-2,4,4-trimethylcyclohex-2-en-1-yl] (3Z)-4-phenylsulfanylhexa-3,5-dienoate (PubChem CID 5384914) has the molecular formula C22H26O3S and a molecular weight of 370.51 g/mol. Its IUPAC name is [(1R)-3-formyl-2,4,4-trimethylcyclohex-2-en-1-yl] (3Z)-4-phenylsulfanylhexa-3,5-dienoate.
| Compound Name | [(1R)-3-formyl-2,4,4-trimethylcyclohex-2-en-1-yl] (3Z)-4-phenylsulfanylhexa-3,5-dienoate |
|---|---|
| PubChem CID | 5384914 |
| Molecular Formula | C22H26O3S |
| Molecular Weight | 370.51 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | [(1R)-3-formyl-2,4,4-trimethylcyclohex-2-en-1-yl] (3Z)-4-phenylsulfanylhexa-3,5-dienoate |
| SMILES | C=C/C(=C/CC(=O)O[C@@H]1CCC(C)(C)C(C=O)=C1C)Sc1ccccc1 |
| InChI | InChI=1S/C22H26O3S/c1-5-17(26-18-9-7-6-8-10-18)11-12-21(24)25-20-13-14-22(3,4)19(15-23)16(20)2/h5-11,15,20H,1,12-14H2,2-4H3/b17-11-/t20-/m1/s1 |
| InChIKey | LYWRMANBBXPXAO-ZZODWALSSA-N |
| XLogP | 5.49 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.51 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|