C14H14O2S — CID 11791477
(3aR,4R,6aS)-4-(phenylsulfanylmethyl)-3,3a,4,6a-tetrahydrocyclopenta[b]furan-2-one (PubChem CID 11791477) has the molecular formula C14H14O2S and a molecular weight of 246.33 g/mol. Its IUPAC name is (3aR,4R,6aS)-4-(phenylsulfanylmethyl)-3,3a,4,6a-tetrahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,4R,6aS)-4-(phenylsulfanylmethyl)-3,3a,4,6a-tetrahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 11791477 |
| Molecular Formula | C14H14O2S |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | (3aR,4R,6aS)-4-(phenylsulfanylmethyl)-3,3a,4,6a-tetrahydrocyclopenta[b]furan-2-one |
| SMILES | O=C1C[C@H]2[C@H](C=C[C@H]2CSc2ccccc2)O1 |
| InChI | InChI=1S/C14H14O2S/c15-14-8-12-10(6-7-13(12)16-14)9-17-11-4-2-1-3-5-11/h1-7,10,12-13H,8-9H2/t10-,12+,13-/m0/s1 |
| InChIKey | VPCYGKBASOUCKJ-UHTWSYAYSA-N |
| XLogP | 2.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|