C22H18N2O2 — CID 132839464
2-(4-methoxyphenyl)-4-phenyl-3H-1,4-benzodiazepin-5-one (PubChem CID 132839464) has the molecular formula C22H18N2O2 and a molecular weight of 342.40 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-4-phenyl-3H-1,4-benzodiazepin-5-one.
| Compound Name | 2-(4-methoxyphenyl)-4-phenyl-3H-1,4-benzodiazepin-5-one |
|---|---|
| PubChem CID | 132839464 |
| Molecular Formula | C22H18N2O2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 2-(4-methoxyphenyl)-4-phenyl-3H-1,4-benzodiazepin-5-one |
| SMILES | COc1ccc(C2=Nc3ccccc3C(=O)N(c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C22H18N2O2/c1-26-18-13-11-16(12-14-18)21-15-24(17-7-3-2-4-8-17)22(25)19-9-5-6-10-20(19)23-21/h2-14H,15H2,1H3 |
| InChIKey | VNEMIUHMEYRJKR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |