C11H17Cl2NO — CID 132843394
1-(3-chloro-4-propoxyphenyl)-N-methylmethanamine;hydrochloride (PubChem CID 132843394) has the molecular formula C11H17Cl2NO and a molecular weight of 250.17 g/mol. Its IUPAC name is 1-(3-chloro-4-propoxyphenyl)-N-methylmethanamine;hydrochloride.
| Compound Name | 1-(3-chloro-4-propoxyphenyl)-N-methylmethanamine;hydrochloride |
|---|---|
| PubChem CID | 132843394 |
| Molecular Formula | C11H17Cl2NO |
| Molecular Weight | 250.17 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 1-(3-chloro-4-propoxyphenyl)-N-methylmethanamine;hydrochloride |
| SMILES | CCCOc1ccc(CNC)cc1Cl.Cl |
| InChI | InChI=1S/C11H16ClNO.ClH/c1-3-6-14-11-5-4-9(8-13-2)7-10(11)12;/h4-5,7,13H,3,6,8H2,1-2H3;1H |
| InChIKey | OTSGMSBNULMDQN-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.17 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |