C13H19ClN2O2 — CID 63889885
4-[2-chloro-4-(methylaminomethyl)phenoxy]-N-methylbutanamide (PubChem CID 63889885) has the molecular formula C13H19ClN2O2 and a molecular weight of 270.76 g/mol. Its IUPAC name is 4-[2-chloro-4-(methylaminomethyl)phenoxy]-N-methylbutanamide.
| Compound Name | 4-[2-chloro-4-(methylaminomethyl)phenoxy]-N-methylbutanamide |
|---|---|
| PubChem CID | 63889885 |
| Molecular Formula | C13H19ClN2O2 |
| Molecular Weight | 270.76 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 4-[2-chloro-4-(methylaminomethyl)phenoxy]-N-methylbutanamide |
| SMILES | CNCc1ccc(OCCCC(=O)NC)c(Cl)c1 |
| InChI | InChI=1S/C13H19ClN2O2/c1-15-9-10-5-6-12(11(14)8-10)18-7-3-4-13(17)16-2/h5-6,8,15H,3-4,7,9H2,1-2H3,(H,16,17) |
| InChIKey | UNTPUOYYYJCOBX-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.76 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|