C16H8N2O2S — CID 132849197
19-oxa-9-thia-2,11-diazapentacyclo[10.8.0.02,10.03,8.013,18]icosa-1(12),3,5,7,10,13,15,17-octaen-20-one (PubChem CID 132849197) has the molecular formula C16H8N2O2S and a molecular weight of 292.32 g/mol. Its IUPAC name is 19-oxa-9-thia-2,11-diazapentacyclo[10.8.0.02,10.03,8.013,18]icosa-1(12),3,5,7,10,13,15,17-octaen-20-one.
| Compound Name | 19-oxa-9-thia-2,11-diazapentacyclo[10.8.0.02,10.03,8.013,18]icosa-1(12),3,5,7,10,13,15,17-octaen-20-one |
|---|---|
| PubChem CID | 132849197 |
| Molecular Formula | C16H8N2O2S |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | 19-oxa-9-thia-2,11-diazapentacyclo[10.8.0.02,10.03,8.013,18]icosa-1(12),3,5,7,10,13,15,17-octaen-20-one |
| SMILES | O=c1oc2ccccc2c2nc3sc4ccccc4n3c12 |
| InChI | InChI=1S/C16H8N2O2S/c19-15-14-13(9-5-1-3-7-11(9)20-15)17-16-18(14)10-6-2-4-8-12(10)21-16/h1-8H |
| InChIKey | UDNITNQTNGNMRL-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 47.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|