C35H38N8O2+2 — CID 132850561
amino-[2-[4-[7-[4-[6-[amino(methylidene)azaniumyl]-1H-benzimidazol-2-yl]phenoxy]heptoxy]phenyl]-3H-benzimidazol-5-yl]-methylideneazanium (PubChem CID 132850561) has the molecular formula C35H38N8O2+2 and a molecular weight of 602.74 g/mol. Its IUPAC name is amino-[2-[4-[7-[4-[6-[amino(methylidene)azaniumyl]-1H-benzimidazol-2-yl]phenoxy]heptoxy]phenyl]-3H-benzimidazol-5-yl]-methylideneazanium.
| Compound Name | amino-[2-[4-[7-[4-[6-[amino(methylidene)azaniumyl]-1H-benzimidazol-2-yl]phenoxy]heptoxy]phenyl]-3H-benzimidazol-5-yl]-methylideneazanium |
|---|---|
| PubChem CID | 132850561 |
| Molecular Formula | C35H38N8O2+2 |
| Molecular Weight | 602.74 g/mol |
| Exact Mass | 602.31 |
| IUPAC Name | amino-[2-[4-[7-[4-[6-[amino(methylidene)azaniumyl]-1H-benzimidazol-2-yl]phenoxy]heptoxy]phenyl]-3H-benzimidazol-5-yl]-methylideneazanium |
| SMILES | C=[N+](N)c1ccc2nc(-c3ccc(OCCCCCCCOc4ccc(-c5nc6ccc([N+](=C)N)cc6[nH]5)cc4)cc3)[nH]c2c1 |
| InChI | InChI=1S/C35H38N8O2/c1-42(36)26-12-18-30-32(22-26)40-34(38-30)24-8-14-28(15-9-24)44-20-6-4-3-5-7-21-45-29-16-10-25(11-17-29)35-39-31-19-13-27(43(2)37)23-33(31)41-35/h8-19,22-23H,1-7,20-21,36-37H2,(H,38,40)(H,39,41)/q+2 |
| InChIKey | SERZKQGECRMYQI-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 133.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.74 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|