C20H18N2O2 — CID 87214846
2-(4-hex-5-ynoxyphenyl)-3H-benzimidazole-5-carbaldehyde (PubChem CID 87214846) has the molecular formula C20H18N2O2 and a molecular weight of 318.38 g/mol. Its IUPAC name is 2-(4-hex-5-ynoxyphenyl)-3H-benzimidazole-5-carbaldehyde.
| Compound Name | 2-(4-hex-5-ynoxyphenyl)-3H-benzimidazole-5-carbaldehyde |
|---|---|
| PubChem CID | 87214846 |
| Molecular Formula | C20H18N2O2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 2-(4-hex-5-ynoxyphenyl)-3H-benzimidazole-5-carbaldehyde |
| SMILES | C#CCCCCOc1ccc(-c2nc3ccc(C=O)cc3[nH]2)cc1 |
| InChI | InChI=1S/C20H18N2O2/c1-2-3-4-5-12-24-17-9-7-16(8-10-17)20-21-18-11-6-15(14-23)13-19(18)22-20/h1,6-11,13-14H,3-5,12H2,(H,21,22) |
| InChIKey | RRCRANQYEQMKAN-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|