C13H14N2O2 — CID 13285707
2,2,5-trimethyl-3H-[1,3]oxazino[5,6-b]indol-4-one (PubChem CID 13285707) has the molecular formula C13H14N2O2 and a molecular weight of 230.27 g/mol. Its IUPAC name is 2,2,5-trimethyl-3H-[1,3]oxazino[5,6-b]indol-4-one.
| Compound Name | 2,2,5-trimethyl-3H-[1,3]oxazino[5,6-b]indol-4-one |
|---|---|
| PubChem CID | 13285707 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 2,2,5-trimethyl-3H-[1,3]oxazino[5,6-b]indol-4-one |
| SMILES | Cn1c2c(c3ccccc31)OC(C)(C)NC2=O |
| InChI | InChI=1S/C13H14N2O2/c1-13(2)14-12(16)10-11(17-13)8-6-4-5-7-9(8)15(10)3/h4-7H,1-3H3,(H,14,16) |
| InChIKey | CLHCDPRYXKGNHJ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |