C13H26O2Si — CID 13289142
(E,2R,3S)-5-[tert-butyl(dimethyl)silyl]-2,3-dimethylpent-4-enoic acid (PubChem CID 13289142) has the molecular formula C13H26O2Si and a molecular weight of 242.44 g/mol. Its IUPAC name is (E,2R,3S)-5-[tert-butyl(dimethyl)silyl]-2,3-dimethylpent-4-enoic acid.
| Compound Name | (E,2R,3S)-5-[tert-butyl(dimethyl)silyl]-2,3-dimethylpent-4-enoic acid |
|---|---|
| PubChem CID | 13289142 |
| Molecular Formula | C13H26O2Si |
| Molecular Weight | 242.44 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | (E,2R,3S)-5-[tert-butyl(dimethyl)silyl]-2,3-dimethylpent-4-enoic acid |
| SMILES | C[C@H](/C=C/[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)O |
| InChI | InChI=1S/C13H26O2Si/c1-10(11(2)12(14)15)8-9-16(6,7)13(3,4)5/h8-11H,1-7H3,(H,14,15)/b9-8+/t10-,11-/m1/s1 |
| InChIKey | WZAHEOWZIMGKAW-WUNNSPOASA-N |
| XLogP | 3.95 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|