C9H18O3Si — CID 44521629
methyl (E,2R)-5-[hydroxy(dimethyl)silyl]-2-methylpent-4-enoate (PubChem CID 44521629) has the molecular formula C9H18O3Si and a molecular weight of 202.33 g/mol. Its IUPAC name is methyl (E,2R)-5-[hydroxy(dimethyl)silyl]-2-methylpent-4-enoate.
| Compound Name | methyl (E,2R)-5-[hydroxy(dimethyl)silyl]-2-methylpent-4-enoate |
|---|---|
| PubChem CID | 44521629 |
| Molecular Formula | C9H18O3Si |
| Molecular Weight | 202.33 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | methyl (E,2R)-5-[hydroxy(dimethyl)silyl]-2-methylpent-4-enoate |
| SMILES | COC(=O)[C@H](C)C/C=C/[Si](C)(C)O |
| InChI | InChI=1S/C9H18O3Si/c1-8(9(10)12-2)6-5-7-13(3,4)11/h5,7-8,11H,6H2,1-4H3/b7-5+/t8-/m1/s1 |
| InChIKey | JYIHOJQWDPTEFZ-WVXIBAHESA-N |
| XLogP | 1.48 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.33 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|