C15H16Cl2OS — CID 13290035
6,7-dichloro-2-cyclohexyl-5-methoxy-1-benzothiophene (PubChem CID 13290035) has the molecular formula C15H16Cl2OS and a molecular weight of 315.27 g/mol. Its IUPAC name is 6,7-dichloro-2-cyclohexyl-5-methoxy-1-benzothiophene.
| Compound Name | 6,7-dichloro-2-cyclohexyl-5-methoxy-1-benzothiophene |
|---|---|
| PubChem CID | 13290035 |
| Molecular Formula | C15H16Cl2OS |
| Molecular Weight | 315.27 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | 6,7-dichloro-2-cyclohexyl-5-methoxy-1-benzothiophene |
| SMILES | COc1cc2cc(C3CCCCC3)sc2c(Cl)c1Cl |
| InChI | InChI=1S/C15H16Cl2OS/c1-18-11-7-10-8-12(9-5-3-2-4-6-9)19-15(10)14(17)13(11)16/h7-9H,2-6H2,1H3 |
| InChIKey | ZTOVITQMRBOFMF-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.27 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |