C11H9ClN2O2S — CID 13290682
methyl 5-(2-chlorophenyl)-2-sulfanylidene-1,3-dihydroimidazole-4-carboxylate (PubChem CID 13290682) has the molecular formula C11H9ClN2O2S and a molecular weight of 268.73 g/mol. Its IUPAC name is methyl 5-(2-chlorophenyl)-2-sulfanylidene-1,3-dihydroimidazole-4-carboxylate.
| Compound Name | methyl 5-(2-chlorophenyl)-2-sulfanylidene-1,3-dihydroimidazole-4-carboxylate |
|---|---|
| PubChem CID | 13290682 |
| Molecular Formula | C11H9ClN2O2S |
| Molecular Weight | 268.73 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | methyl 5-(2-chlorophenyl)-2-sulfanylidene-1,3-dihydroimidazole-4-carboxylate |
| SMILES | COC(=O)c1[nH]c(=S)[nH]c1-c1ccccc1Cl |
| InChI | InChI=1S/C11H9ClN2O2S/c1-16-10(15)9-8(13-11(17)14-9)6-4-2-3-5-7(6)12/h2-5H,1H3,(H2,13,14,17) |
| InChIKey | JRYNWXOQTXJCKF-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 57.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.73 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|