C6H13ClO2S — CID 13291396
(2R,3R)-3-[(R)-2-chloroethylsulfinyl]butan-2-ol (PubChem CID 13291396) has the molecular formula C6H13ClO2S and a molecular weight of 184.69 g/mol. Its IUPAC name is (2R,3R)-3-[(R)-2-chloroethylsulfinyl]butan-2-ol.
| Compound Name | (2R,3R)-3-[(R)-2-chloroethylsulfinyl]butan-2-ol |
|---|---|
| PubChem CID | 13291396 |
| Molecular Formula | C6H13ClO2S |
| Molecular Weight | 184.69 g/mol |
| Exact Mass | 184.03 |
| IUPAC Name | (2R,3R)-3-[(R)-2-chloroethylsulfinyl]butan-2-ol |
| SMILES | C[C@H]([C@@H](C)O)[S@](=O)CCCl |
| InChI | InChI=1S/C6H13ClO2S/c1-5(8)6(2)10(9)4-3-7/h5-6,8H,3-4H2,1-2H3/t5-,6-,10-/m1/s1 |
| InChIKey | XVPBKZQFEUHTQA-OXOINMOOSA-N |
| XLogP | 0.74 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.69 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|