C20H20O5 — CID 132915901
(2S)-7-hydroxy-8-[(E)-4-hydroxy-3-methylbut-2-enyl]-2-(4-hydroxyphenyl)-2,3-dihydrochromen-4-one (PubChem CID 132915901) has the molecular formula C20H20O5 and a molecular weight of 340.38 g/mol. Its IUPAC name is (2S)-7-hydroxy-8-[(E)-4-hydroxy-3-methylbut-2-enyl]-2-(4-hydroxyphenyl)-2,3-dihydrochromen-4-one.
| Compound Name | (2S)-7-hydroxy-8-[(E)-4-hydroxy-3-methylbut-2-enyl]-2-(4-hydroxyphenyl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 132915901 |
| Molecular Formula | C20H20O5 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | (2S)-7-hydroxy-8-[(E)-4-hydroxy-3-methylbut-2-enyl]-2-(4-hydroxyphenyl)-2,3-dihydrochromen-4-one |
| SMILES | C/C(=C\Cc1c(O)ccc2c1O[C@H](c1ccc(O)cc1)CC2=O)CO |
| InChI | InChI=1S/C20H20O5/c1-12(11-21)2-7-15-17(23)9-8-16-18(24)10-19(25-20(15)16)13-3-5-14(22)6-4-13/h2-6,8-9,19,21-23H,7,10-11H2,1H3/b12-2+/t19-/m0/s1 |
| InChIKey | OVDLBBJONXMYFH-KZSGQICFSA-N |
| XLogP | 3.29 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|