C13H7BrN2S — CID 132915932
4-bromo-16-thia-2,8-diazatetracyclo[7.7.0.02,7.010,15]hexadeca-1(9),3,5,7,10,12,14-heptaene (PubChem CID 132915932) has the molecular formula C13H7BrN2S and a molecular weight of 303.18 g/mol. Its IUPAC name is 4-bromo-16-thia-2,8-diazatetracyclo[7.7.0.02,7.010,15]hexadeca-1(9),3,5,7,10,12,14-heptaene.
| Compound Name | 4-bromo-16-thia-2,8-diazatetracyclo[7.7.0.02,7.010,15]hexadeca-1(9),3,5,7,10,12,14-heptaene |
|---|---|
| PubChem CID | 132915932 |
| Molecular Formula | C13H7BrN2S |
| Molecular Weight | 303.18 g/mol |
| Exact Mass | 301.95 |
| IUPAC Name | 4-bromo-16-thia-2,8-diazatetracyclo[7.7.0.02,7.010,15]hexadeca-1(9),3,5,7,10,12,14-heptaene |
| SMILES | Brc1ccc2nc3c4ccccc4sc3n2c1 |
| InChI | InChI=1S/C13H7BrN2S/c14-8-5-6-11-15-12-9-3-1-2-4-10(9)17-13(12)16(11)7-8/h1-7H |
| InChIKey | IXLPVHBTBOWSNX-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.18 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |