C14H10N2S — CID 132915926
4-methyl-16-thia-2,8-diazatetracyclo[7.7.0.02,7.010,15]hexadeca-1(9),3,5,7,10,12,14-heptaene (PubChem CID 132915926) has the molecular formula C14H10N2S and a molecular weight of 238.32 g/mol. Its IUPAC name is 4-methyl-16-thia-2,8-diazatetracyclo[7.7.0.02,7.010,15]hexadeca-1(9),3,5,7,10,12,14-heptaene.
| Compound Name | 4-methyl-16-thia-2,8-diazatetracyclo[7.7.0.02,7.010,15]hexadeca-1(9),3,5,7,10,12,14-heptaene |
|---|---|
| PubChem CID | 132915926 |
| Molecular Formula | C14H10N2S |
| Molecular Weight | 238.32 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 4-methyl-16-thia-2,8-diazatetracyclo[7.7.0.02,7.010,15]hexadeca-1(9),3,5,7,10,12,14-heptaene |
| SMILES | Cc1ccc2nc3c4ccccc4sc3n2c1 |
| InChI | InChI=1S/C14H10N2S/c1-9-6-7-12-15-13-10-4-2-3-5-11(10)17-14(13)16(12)8-9/h2-8H,1H3 |
| InChIKey | JQHZUGSKJUMAQJ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.32 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |