C19H17F3O — CID 132915994
2-[(E)-2-phenyl-2-[4-(trifluoromethyl)phenyl]ethenyl]oxolane (PubChem CID 132915994) has the molecular formula C19H17F3O and a molecular weight of 318.34 g/mol. Its IUPAC name is 2-[(E)-2-phenyl-2-[4-(trifluoromethyl)phenyl]ethenyl]oxolane.
| Compound Name | 2-[(E)-2-phenyl-2-[4-(trifluoromethyl)phenyl]ethenyl]oxolane |
|---|---|
| PubChem CID | 132915994 |
| Molecular Formula | C19H17F3O |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 2-[(E)-2-phenyl-2-[4-(trifluoromethyl)phenyl]ethenyl]oxolane |
| SMILES | FC(F)(F)c1ccc(/C(=C/C2CCCO2)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H17F3O/c20-19(21,22)16-10-8-15(9-11-16)18(13-17-7-4-12-23-17)14-5-2-1-3-6-14/h1-3,5-6,8-11,13,17H,4,7,12H2/b18-13+ |
| InChIKey | ROOBNHFLDYMDCG-QGOAFFKASA-N |
| XLogP | 5.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |