C52H36F6 — CID 160707520
1,2-bis[2-[2-[(Z)-2-phenyl-2-[4-(trifluoromethyl)phenyl]ethenyl]phenyl]ethenyl]benzene (PubChem CID 160707520) has the molecular formula C52H36F6 and a molecular weight of 774.85 g/mol. Its IUPAC name is 1,2-bis[2-[2-[(Z)-2-phenyl-2-[4-(trifluoromethyl)phenyl]ethenyl]phenyl]ethenyl]benzene.
| Compound Name | 1,2-bis[2-[2-[(Z)-2-phenyl-2-[4-(trifluoromethyl)phenyl]ethenyl]phenyl]ethenyl]benzene |
|---|---|
| PubChem CID | 160707520 |
| Molecular Formula | C52H36F6 |
| Molecular Weight | 774.85 g/mol |
| Exact Mass | 774.27 |
| IUPAC Name | 1,2-bis[2-[2-[(Z)-2-phenyl-2-[4-(trifluoromethyl)phenyl]ethenyl]phenyl]ethenyl]benzene |
| SMILES | FC(F)(F)c1ccc(/C(=C\c2ccccc2C=Cc2ccccc2C=Cc2ccccc2/C=C(/c2ccccc2)c2ccc(C(F)(F)F)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C52H36F6/c53-51(54,55)47-31-27-43(28-32-47)49(41-17-3-1-4-18-41)35-45-21-11-9-15-39(45)25-23-37-13-7-8-14-38(37)24-26-40-16-10-12-22-46(40)36-50(42-19-5-2-6-20-42)44-29-33-48(34-30-44)52(56,57)58/h1-36H/b25-23?,26-24?,49-35-,50-36- |
| InChIKey | RRKNGUDSXCMWQE-YSNGDPFFSA-N |
| XLogP | 15.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.85 |
| LogP ≤ 5 | 15.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|