C17H13BrClFO2S — CID 132916101
[(Z)-3-(4-bromophenyl)-3-chloro-2-(4-fluorophenyl)sulfanylprop-2-enyl] acetate (PubChem CID 132916101) has the molecular formula C17H13BrClFO2S and a molecular weight of 415.71 g/mol. Its IUPAC name is [(Z)-3-(4-bromophenyl)-3-chloro-2-(4-fluorophenyl)sulfanylprop-2-enyl] acetate.
| Compound Name | [(Z)-3-(4-bromophenyl)-3-chloro-2-(4-fluorophenyl)sulfanylprop-2-enyl] acetate |
|---|---|
| PubChem CID | 132916101 |
| Molecular Formula | C17H13BrClFO2S |
| Molecular Weight | 415.71 g/mol |
| Exact Mass | 413.95 |
| IUPAC Name | [(Z)-3-(4-bromophenyl)-3-chloro-2-(4-fluorophenyl)sulfanylprop-2-enyl] acetate |
| SMILES | CC(=O)OC/C(Sc1ccc(F)cc1)=C(/Cl)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H13BrClFO2S/c1-11(21)22-10-16(23-15-8-6-14(20)7-9-15)17(19)12-2-4-13(18)5-3-12/h2-9H,10H2,1H3/b17-16- |
| InChIKey | JPJYEJQTMBAPJJ-MSUUIHNZSA-N |
| XLogP | 5.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.71 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |